C19H18Cl2N2O — CID 124760539
(3S,7aS)-2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one (PubChem CID 124760539) has the molecular formula C19H18Cl2N2O and a molecular weight of 361.27 g/mol. Its IUPAC name is (3S,7aS)-2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one.
| Compound Name | (3S,7aS)-2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
|---|---|
| PubChem CID | 124760539 |
| Molecular Formula | C19H18Cl2N2O |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (3S,7aS)-2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
| SMILES | Cc1ccc([C@@H]2N(c3ccc(Cl)c(Cl)c3)C(=O)[C@@H]3CCCN23)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O/c1-12-4-6-13(7-5-12)18-22-10-2-3-17(22)19(24)23(18)14-8-9-15(20)16(21)11-14/h4-9,11,17-18H,2-3,10H2,1H3/t17-,18-/m0/s1 |
| InChIKey | NEKXQFPDYHNXJB-ROUUACIJSA-N |
| XLogP | 4.81 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |