C22H17NO5 — CID 124763067
(1R,2R,6R,7R)-4-[4-(1,3-benzodioxol-5-yloxy)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 124763067) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-[4-(1,3-benzodioxol-5-yloxy)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-[4-(1,3-benzodioxol-5-yloxy)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 124763067 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (1R,2R,6R,7R)-4-[4-(1,3-benzodioxol-5-yloxy)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1c1ccc(Oc3ccc4c(c3)OCO4)cc1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C22H17NO5/c24-21-19-12-1-2-13(9-12)20(19)22(25)23(21)14-3-5-15(6-4-14)28-16-7-8-17-18(10-16)27-11-26-17/h1-8,10,12-13,19-20H,9,11H2/t12-,13-,19+,20+/m0/s1 |
| InChIKey | QQPYDLFOXKZNHL-ISZNXKAUSA-N |
| XLogP | 3.52 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|