C25H19NO3 — CID 124763174
(1S,2R,6R,7S,8R,10R)-4-[4-(1-benzofuran-2-yl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 124763174) has the molecular formula C25H19NO3 and a molecular weight of 381.43 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,10R)-4-[4-(1-benzofuran-2-yl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S,8R,10R)-4-[4-(1-benzofuran-2-yl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 124763174 |
| Molecular Formula | C25H19NO3 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (1S,2R,6R,7S,8R,10R)-4-[4-(1-benzofuran-2-yl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@@H]34)[C@H]2C(=O)N1c1ccc(-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C25H19NO3/c27-24-22-16-9-10-17(19-12-18(16)19)23(22)25(28)26(24)15-7-5-13(6-8-15)21-11-14-3-1-2-4-20(14)29-21/h1-11,16-19,22-23H,12H2/t16-,17-,18-,19-,22+,23+/m0/s1 |
| InChIKey | ZPRFWGVOJIMMSJ-HAGYDGCBSA-N |
| XLogP | 4.66 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|