C19H21N3O4 — CID 124763451
(1R,2R,6R,7R)-4-[(Z)-[5-(morpholin-4-ylmethyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 124763451) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-[(Z)-[5-(morpholin-4-ylmethyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-[(Z)-[5-(morpholin-4-ylmethyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 124763451 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (1R,2R,6R,7R)-4-[(Z)-[5-(morpholin-4-ylmethyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1/N=C\c1ccc(CN3CCOCC3)o1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C19H21N3O4/c23-18-16-12-1-2-13(9-12)17(16)19(24)22(18)20-10-14-3-4-15(26-14)11-21-5-7-25-8-6-21/h1-4,10,12-13,16-17H,5-9,11H2/b20-10-/t12-,13-,16+,17+/m0/s1 |
| InChIKey | MREMLKNSZWUHNB-QSEOVUAOSA-N |
| XLogP | 1.25 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|