C11H12Br2 — CID 124764003
(1R,2S,3S,5S,6S,8S,9R,10S)-4,4-dibromopentacyclo[6.3.0.02,6.03,10.05,9]undecane (PubChem CID 124764003) has the molecular formula C11H12Br2 and a molecular weight of 304.03 g/mol. Its IUPAC name is (1R,2S,3S,5S,6S,8S,9R,10S)-4,4-dibromopentacyclo[6.3.0.02,6.03,10.05,9]undecane.
| Compound Name | (1R,2S,3S,5S,6S,8S,9R,10S)-4,4-dibromopentacyclo[6.3.0.02,6.03,10.05,9]undecane |
|---|---|
| PubChem CID | 124764003 |
| Molecular Formula | C11H12Br2 |
| Molecular Weight | 304.03 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | (1R,2S,3S,5S,6S,8S,9R,10S)-4,4-dibromopentacyclo[6.3.0.02,6.03,10.05,9]undecane |
| SMILES | BrC1(Br)[C@H]2[C@H]3C[C@H]4[C@H]5C[C@@H]([C@@H]42)[C@H]1[C@@H]53 |
| InChI | InChI=1S/C11H12Br2/c12-11(13)9-5-1-3-4-2-6(7(3)9)10(11)8(4)5/h3-10H,1-2H2/t3-,4+,5-,6-,7+,8-,9-,10-/m0/s1 |
| InChIKey | OLRUHJPVOOXZIZ-KTAYFMQGSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.03 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|