C25H32N2O5 — CID 124764101
[(2S)-1-(tert-butylamino)-1-oxobutan-2-yl] (1R,5R,6R,7R)-3-(2,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 124764101) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is [(2S)-1-(tert-butylamino)-1-oxobutan-2-yl] (1R,5R,6R,7R)-3-(2,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | [(2S)-1-(tert-butylamino)-1-oxobutan-2-yl] (1R,5R,6R,7R)-3-(2,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 124764101 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | [(2S)-1-(tert-butylamino)-1-oxobutan-2-yl] (1R,5R,6R,7R)-3-(2,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CC[C@H](OC(=O)[C@@H]1[C@H]2C(=O)N(c3ccc(C)cc3C)C[C@@]23C=C[C@H]1O3)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C25H32N2O5/c1-7-17(21(28)26-24(4,5)6)31-23(30)19-18-10-11-25(32-18)13-27(22(29)20(19)25)16-9-8-14(2)12-15(16)3/h8-12,17-20H,7,13H2,1-6H3,(H,26,28)/t17-,18+,19-,20-,25-/m0/s1 |
| InChIKey | PYTPVJGHIUBBRS-MDFABALLSA-N |
| XLogP | 2.83 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|