C24H25N3O5S2 — CID 124764633
(2R)-2-[(1R,2S,9R,10R,11S,12S,16S)-9-[4-(dimethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 124764633) has the molecular formula C24H25N3O5S2 and a molecular weight of 499.61 g/mol. Its IUPAC name is (2R)-2-[(1R,2S,9R,10R,11S,12S,16S)-9-[4-(dimethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | (2R)-2-[(1R,2S,9R,10R,11S,12S,16S)-9-[4-(dimethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 124764633 |
| Molecular Formula | C24H25N3O5S2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | (2R)-2-[(1R,2S,9R,10R,11S,12S,16S)-9-[4-(dimethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | C[C@H](C(=O)O)N1C(=O)[C@@H]2[C@H]3C[C@@H]([C@@H]2C1=O)[C@@H]1[C@H](c2ccc(N(C)C)cc2)c2sc(=O)[nH]c2S[C@@H]31 |
| InChI | InChI=1S/C24H25N3O5S2/c1-9(23(30)31)27-21(28)16-12-8-13(17(16)22(27)29)18-15(12)14(19-20(33-18)25-24(32)34-19)10-4-6-11(7-5-10)26(2)3/h4-7,9,12-18H,8H2,1-3H3,(H,25,32)(H,30,31)/t9-,12-,13-,14+,15-,16+,17-,18+/m1/s1 |
| InChIKey | FBHZBLHSTRRTPG-HLWUTDBPSA-N |
| XLogP | 2.45 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|