C25H35N3O4 — CID 124765236
(1R,2R,5S,6S,7R)-2-N,6-N,3-tricyclopentyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 124765236) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is (1R,2R,5S,6S,7R)-2-N,6-N,3-tricyclopentyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6S,7R)-2-N,6-N,3-tricyclopentyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 124765236 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | (1R,2R,5S,6S,7R)-2-N,6-N,3-tricyclopentyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | O=C(NC1CCCC1)[C@@H]1[C@H]2C=C[C@]3(O2)[C@H](C(=O)NC2CCCC2)N(C2CCCC2)C(=O)[C@@H]13 |
| InChI | InChI=1S/C25H35N3O4/c29-22(26-15-7-1-2-8-15)19-18-13-14-25(32-18)20(19)24(31)28(17-11-5-6-12-17)21(25)23(30)27-16-9-3-4-10-16/h13-21H,1-12H2,(H,26,29)(H,27,30)/t18-,19-,20-,21+,25-/m1/s1 |
| InChIKey | AJUGEODEELKVEN-JWEZWNSLSA-N |
| XLogP | 2.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|