C25H28N2O6S — CID 124765343
methyl (1R,3S,3aS,6aS)-5-(4-ethoxyphenyl)-1-(4-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 124765343) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is methyl (1R,3S,3aS,6aS)-5-(4-ethoxyphenyl)-1-(4-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aS,6aS)-5-(4-ethoxyphenyl)-1-(4-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 124765343 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | methyl (1R,3S,3aS,6aS)-5-(4-ethoxyphenyl)-1-(4-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCOc1ccc(N2C(=O)[C@@H]3[C@H](c4ccc(O)cc4)N[C@](CCSC)(C(=O)OC)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H28N2O6S/c1-4-33-18-11-7-16(8-12-18)27-22(29)19-20(23(27)30)25(13-14-34-3,24(31)32-2)26-21(19)15-5-9-17(28)10-6-15/h5-12,19-21,26,28H,4,13-14H2,1-3H3/t19-,20+,21-,25-/m0/s1 |
| InChIKey | CJNJMFNRNBHDNJ-PDFGSZSQSA-N |
| XLogP | 2.91 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|