C15H15NO2S — CID 124765665
(1S,2R,6R,7S)-4-(2-sulfanylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 124765665) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is (1S,2R,6R,7S)-4-(2-sulfanylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6R,7S)-4-(2-sulfanylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 124765665 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (1S,2R,6R,7S)-4-(2-sulfanylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3CC[C@@H](C3)[C@H]2C(=O)N1c1ccccc1S |
| InChI | InChI=1S/C15H15NO2S/c17-14-12-8-5-6-9(7-8)13(12)15(18)16(14)10-3-1-2-4-11(10)19/h1-4,8-9,12-13,19H,5-7H2/t8-,9-,12+,13+/m0/s1 |
| InChIKey | JTNJSFCPMPXINI-RBJBARPLSA-N |
| XLogP | 2.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|