C17H20N2O6 — CID 124765891
ethyl (1S,3S,3aR,6aR)-3-(hydroxymethyl)-1-(4-hydroxyphenyl)-5-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 124765891) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is ethyl (1S,3S,3aR,6aR)-3-(hydroxymethyl)-1-(4-hydroxyphenyl)-5-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (1S,3S,3aR,6aR)-3-(hydroxymethyl)-1-(4-hydroxyphenyl)-5-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 124765891 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | ethyl (1S,3S,3aR,6aR)-3-(hydroxymethyl)-1-(4-hydroxyphenyl)-5-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(CO)N[C@H](c2ccc(O)cc2)[C@@H]2C(=O)N(C)C(=O)[C@H]21 |
| InChI | InChI=1S/C17H20N2O6/c1-3-25-16(24)17(8-20)12-11(14(22)19(2)15(12)23)13(18-17)9-4-6-10(21)7-5-9/h4-7,11-13,18,20-21H,3,8H2,1-2H3/t11-,12+,13-,17-/m1/s1 |
| InChIKey | OALIPXYYNPHKMS-IPJQOSJUSA-N |
| XLogP | -0.44 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|