C28H28FN3O4 — CID 124766209
(1R,2S,5R,6S,7R)-2-N-cyclopentyl-3-(2-fluorophenyl)-6-N-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 124766209) has the molecular formula C28H28FN3O4 and a molecular weight of 489.55 g/mol. Its IUPAC name is (1R,2S,5R,6S,7R)-2-N-cyclopentyl-3-(2-fluorophenyl)-6-N-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5R,6S,7R)-2-N-cyclopentyl-3-(2-fluorophenyl)-6-N-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 124766209 |
| Molecular Formula | C28H28FN3O4 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (1R,2S,5R,6S,7R)-2-N-cyclopentyl-3-(2-fluorophenyl)-6-N-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N(c4ccccc4F)[C@H](C(=O)NC4CCCC4)[C@@]34C=C[C@H]2O4)cc1 |
| InChI | InChI=1S/C28H28FN3O4/c1-16-10-12-18(13-11-16)30-25(33)22-21-14-15-28(36-21)23(22)27(35)32(20-9-5-4-8-19(20)29)24(28)26(34)31-17-6-2-3-7-17/h4-5,8-15,17,21-24H,2-3,6-7H2,1H3,(H,30,33)(H,31,34)/t21-,22-,23+,24-,28-/m1/s1 |
| InChIKey | VFSUPXYGEQIATC-SHHGKLNCSA-N |
| XLogP | 3.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|