C15H17N3O4 — CID 124766587
methyl (4R,5R,6S)-6-hydroxy-6-methyl-3-oxo-4-pyridin-3-yl-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate (PubChem CID 124766587) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl (4R,5R,6S)-6-hydroxy-6-methyl-3-oxo-4-pyridin-3-yl-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate.
| Compound Name | methyl (4R,5R,6S)-6-hydroxy-6-methyl-3-oxo-4-pyridin-3-yl-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 124766587 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | methyl (4R,5R,6S)-6-hydroxy-6-methyl-3-oxo-4-pyridin-3-yl-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2cccnc2)c2c([nH][nH]c2=O)C[C@]1(C)O |
| InChI | InChI=1S/C15H17N3O4/c1-15(21)6-9-11(13(19)18-17-9)10(12(15)14(20)22-2)8-4-3-5-16-7-8/h3-5,7,10,12,21H,6H2,1-2H3,(H2,17,18,19)/t10-,12+,15+/m1/s1 |
| InChIKey | IZHULAXPISZQHL-GMXABZIVSA-N |
| XLogP | 0.33 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |