C16H15Cl5FNO — CID 124766638
trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(4-fluorophenyl)ethyl]cyclopropane-1-carboxamide (PubChem CID 124766638) has the molecular formula C16H15Cl5FNO and a molecular weight of 433.57 g/mol. Its IUPAC name is trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(4-fluorophenyl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(4-fluorophenyl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 124766638 |
| Molecular Formula | C16H15Cl5FNO |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(4-fluorophenyl)ethyl]cyclopropane-1-carboxamide |
| SMILES | CC1(C)[C@H](C=C(Cl)Cl)[C@@H]1C(=O)N[C@H](c1ccc(F)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H15Cl5FNO/c1-15(2)10(7-11(17)18)12(15)14(24)23-13(16(19,20)21)8-3-5-9(22)6-4-8/h3-7,10,12-13H,1-2H3,(H,23,24)/t10-,12-,13-/m1/s1 |
| InChIKey | LNTSHRPDUYJBSW-RAIGVLPGSA-N |
| XLogP | 5.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|