C24H17F3N2O3S3 — CID 124767084
(1R,2R,9S,10R,11S,12S,16S)-9-thiophen-2-yl-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 124767084) has the molecular formula C24H17F3N2O3S3 and a molecular weight of 534.61 g/mol. Its IUPAC name is (1R,2R,9S,10R,11S,12S,16S)-9-thiophen-2-yl-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,2R,9S,10R,11S,12S,16S)-9-thiophen-2-yl-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 124767084 |
| Molecular Formula | C24H17F3N2O3S3 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | (1R,2R,9S,10R,11S,12S,16S)-9-thiophen-2-yl-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@@H]([C@@H]2C(=O)N1c1cccc(C(F)(F)F)c1)[C@@H]1[C@@H](c2cccs2)c2sc(=O)[nH]c2S[C@H]31 |
| InChI | InChI=1S/C24H17F3N2O3S3/c25-24(26,27)9-3-1-4-10(7-9)29-21(30)15-11-8-12(16(15)22(29)31)18-14(11)17(13-5-2-6-33-13)19-20(34-18)28-23(32)35-19/h1-7,11-12,14-18H,8H2,(H,28,32)/t11-,12-,14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | QNYHWFSOIUCAEZ-QUEWECFLSA-N |
| XLogP | 5.19 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|