C17H14N4O6 — CID 124767544
(1R,2S,7R,8R)-4-(2,4-dinitrophenyl)spiro[4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-11,1'-cyclopropane]-3,6-dione (PubChem CID 124767544) has the molecular formula C17H14N4O6 and a molecular weight of 370.32 g/mol. Its IUPAC name is (1R,2S,7R,8R)-4-(2,4-dinitrophenyl)spiro[4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-11,1'-cyclopropane]-3,6-dione.
| Compound Name | (1R,2S,7R,8R)-4-(2,4-dinitrophenyl)spiro[4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-11,1'-cyclopropane]-3,6-dione |
|---|---|
| PubChem CID | 124767544 |
| Molecular Formula | C17H14N4O6 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (1R,2S,7R,8R)-4-(2,4-dinitrophenyl)spiro[4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-11,1'-cyclopropane]-3,6-dione |
| SMILES | O=C1NN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(=O)[C@@H]2[C@H]1[C@H]1C=C[C@H]2C12CC2 |
| InChI | InChI=1S/C17H14N4O6/c22-15-13-9-2-3-10(17(9)5-6-17)14(13)16(23)19(18-15)11-4-1-8(20(24)25)7-12(11)21(26)27/h1-4,7,9-10,13-14H,5-6H2,(H,18,22)/t9-,10-,13-,14+/m1/s1 |
| InChIKey | VXATYHIRCKFCEU-MHWZDGSBSA-N |
| XLogP | 1.71 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|