C29H40O4 — CID 124767836
(1S,3S,4S,5R)-4-hydroxy-3-[[(1S,3R,4S,5R)-4-hydroxy-1,8,8-trimethyl-2-oxo-3-bicyclo[3.2.1]octanyl]-phenylmethyl]-1,8,8-trimethylbicyclo[3.2.1]octan-2-one (PubChem CID 124767836) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is (1S,3S,4S,5R)-4-hydroxy-3-[[(1S,3R,4S,5R)-4-hydroxy-1,8,8-trimethyl-2-oxo-3-bicyclo[3.2.1]octanyl]-phenylmethyl]-1,8,8-trimethylbicyclo[3.2.1]octan-2-one.
| Compound Name | (1S,3S,4S,5R)-4-hydroxy-3-[[(1S,3R,4S,5R)-4-hydroxy-1,8,8-trimethyl-2-oxo-3-bicyclo[3.2.1]octanyl]-phenylmethyl]-1,8,8-trimethylbicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 124767836 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | (1S,3S,4S,5R)-4-hydroxy-3-[[(1S,3R,4S,5R)-4-hydroxy-1,8,8-trimethyl-2-oxo-3-bicyclo[3.2.1]octanyl]-phenylmethyl]-1,8,8-trimethylbicyclo[3.2.1]octan-2-one |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)[C@H](C(c1ccccc1)[C@@H]1C(=O)[C@@]3(C)CC[C@@H]([C@@H]1O)C3(C)C)[C@H]2O |
| InChI | InChI=1S/C29H40O4/c1-26(2)17-12-14-28(26,5)24(32)20(22(17)30)19(16-10-8-7-9-11-16)21-23(31)18-13-15-29(6,25(21)33)27(18,3)4/h7-11,17-23,30-31H,12-15H2,1-6H3/t17-,18-,19?,20-,21+,22-,23-,28+,29+/m0/s1 |
| InChIKey | GKGQAVSTAZKWHH-XJOXUNHLSA-N |
| XLogP | 4.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |