C29H40N2O2S — CID 124767878
3-phenyl-1-[[(1R,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]-1-[[(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]thiourea (PubChem CID 124767878) has the molecular formula C29H40N2O2S and a molecular weight of 480.72 g/mol. Its IUPAC name is 3-phenyl-1-[[(1R,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]-1-[[(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]thiourea.
| Compound Name | 3-phenyl-1-[[(1R,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]-1-[[(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]thiourea |
|---|---|
| PubChem CID | 124767878 |
| Molecular Formula | C29H40N2O2S |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 3-phenyl-1-[[(1R,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]-1-[[(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]thiourea |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C(=O)[C@@H]2CN(C[C@H]1C(=O)[C@@]2(C)CC[C@@H]1C2(C)C)C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C29H40N2O2S/c1-26(2)21-12-14-28(26,5)23(32)19(21)16-31(25(34)30-18-10-8-7-9-11-18)17-20-22-13-15-29(6,24(20)33)27(22,3)4/h7-11,19-22H,12-17H2,1-6H3,(H,30,34)/t19-,20-,21-,22+,28-,29-/m1/s1 |
| InChIKey | HCUKIAODHHOVII-ABJPJVEASA-N |
| XLogP | 5.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|