C17H22Br2O2 — CID 124767936
cis-(1S,3S)-3-[(1R,2S)-1,2-dibromo-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid (PubChem CID 124767936) has the molecular formula C17H22Br2O2 and a molecular weight of 418.17 g/mol. Its IUPAC name is cis-(1S,3S)-3-[(1R,2S)-1,2-dibromo-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3S)-3-[(1R,2S)-1,2-dibromo-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 124767936 |
| Molecular Formula | C17H22Br2O2 |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | cis-(1S,3S)-3-[(1R,2S)-1,2-dibromo-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CC1(C)[C@@H]([C@@H](Br)[C@@H](Br)c2ccccc2)CC[C@]1(C)C(=O)O |
| InChI | InChI=1S/C17H22Br2O2/c1-16(2)12(9-10-17(16,3)15(20)21)14(19)13(18)11-7-5-4-6-8-11/h4-8,12-14H,9-10H2,1-3H3,(H,20,21)/t12-,13+,14-,17-/m1/s1 |
| InChIKey | IPAYRHXWIXEEOF-UMPJEAMMSA-N |
| XLogP | 5.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|