C29H39NO3 — CID 124767976
N-[[(1S,2R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]-N-[[(1R,2R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]benzamide (PubChem CID 124767976) has the molecular formula C29H39NO3 and a molecular weight of 449.64 g/mol. Its IUPAC name is N-[[(1S,2R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]-N-[[(1R,2R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]benzamide.
| Compound Name | N-[[(1S,2R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]-N-[[(1R,2R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]benzamide |
|---|---|
| PubChem CID | 124767976 |
| Molecular Formula | C29H39NO3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | N-[[(1S,2R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]-N-[[(1R,2R,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl]benzamide |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C(=O)[C@H]2CN(C[C@@H]1C(=O)[C@@]2(C)CC[C@@H]1C2(C)C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H39NO3/c1-26(2)21-12-14-28(26,5)23(31)19(21)16-30(25(33)18-10-8-7-9-11-18)17-20-22-13-15-29(6,24(20)32)27(22,3)4/h7-11,19-22H,12-17H2,1-6H3/t19-,20-,21-,22+,28+,29+/m0/s1 |
| InChIKey | JJYPPLLEFKACEV-VOPJWOGISA-N |
| XLogP | 5.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |