C31H28Cl2N2O2 — CID 124769584
(E)-1-[(3S,3aS,5R,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 124769584) has the molecular formula C31H28Cl2N2O2 and a molecular weight of 531.48 g/mol. Its IUPAC name is (E)-1-[(3S,3aS,5R,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3S,3aS,5R,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 124769584 |
| Molecular Formula | C31H28Cl2N2O2 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | (E)-1-[(3S,3aS,5R,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2N=C3/C(=C/c4ccc(Cl)cc4)C[C@H](C)C[C@H]3[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H28Cl2N2O2/c1-20-17-24(19-22-3-10-25(32)11-4-22)30-28(18-20)31(23-8-12-26(33)13-9-23)35(34-30)29(36)16-7-21-5-14-27(37-2)15-6-21/h3-16,19-20,28,31H,17-18H2,1-2H3/b16-7+,24-19+/t20-,28+,31+/m0/s1 |
| InChIKey | ILHWDNMVYIHDSM-KZSLLDGASA-N |
| XLogP | 8.08 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|