C14H17N2O4+ — CID 124770154
(4R,7R,7aR)-7-(4-nitrophenyl)-4-prop-2-enyl-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium (PubChem CID 124770154) has the molecular formula C14H17N2O4+ and a molecular weight of 277.30 g/mol. Its IUPAC name is (4R,7R,7aR)-7-(4-nitrophenyl)-4-prop-2-enyl-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium.
| Compound Name | (4R,7R,7aR)-7-(4-nitrophenyl)-4-prop-2-enyl-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium |
|---|---|
| PubChem CID | 124770154 |
| Molecular Formula | C14H17N2O4+ |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (4R,7R,7aR)-7-(4-nitrophenyl)-4-prop-2-enyl-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-4-ium |
| SMILES | C=CC[N@+]12COC[C@@H]1[C@@H](c1ccc([N+](=O)[O-])cc1)OC2 |
| InChI | InChI=1S/C14H17N2O4/c1-2-7-16-9-19-8-13(16)14(20-10-16)11-3-5-12(6-4-11)15(17)18/h2-6,13-14H,1,7-10H2/q+1/t13-,14-,16-/m1/s1 |
| InChIKey | HSVKZHCWWVPPMF-IIAWOOMASA-N |
| XLogP | 1.98 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|