C30H24Cl2N2O5 — CID 124770310
(3S,3aR,6aR)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-2-phenyl-5-(4-propoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 124770310) has the molecular formula C30H24Cl2N2O5 and a molecular weight of 563.44 g/mol. Its IUPAC name is (3S,3aR,6aR)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-2-phenyl-5-(4-propoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aR)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-2-phenyl-5-(4-propoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 124770310 |
| Molecular Formula | C30H24Cl2N2O5 |
| Molecular Weight | 563.44 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | (3S,3aR,6aR)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-2-phenyl-5-(4-propoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCCOc1ccc(N2C(=O)[C@@H]3[C@@H](c4ccc(-c5ccc(Cl)cc5Cl)o4)N(c4ccccc4)O[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C30H24Cl2N2O5/c1-2-16-37-21-11-9-19(10-12-21)33-29(35)26-27(34(39-28(26)30(33)36)20-6-4-3-5-7-20)25-15-14-24(38-25)22-13-8-18(31)17-23(22)32/h3-15,17,26-28H,2,16H2,1H3/t26-,27-,28-/m1/s1 |
| InChIKey | ODEHUGNLBCBGRS-JCYYIGJDSA-N |
| XLogP | 7.09 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.44 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|