C33H22Cl2N2O3 — CID 124770316
(1'S,2'R,3S,3'aR)-1',2'-bis(2-chlorobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 124770316) has the molecular formula C33H22Cl2N2O3 and a molecular weight of 565.46 g/mol. Its IUPAC name is (1'S,2'R,3S,3'aR)-1',2'-bis(2-chlorobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'R,3S,3'aR)-1',2'-bis(2-chlorobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 124770316 |
| Molecular Formula | C33H22Cl2N2O3 |
| Molecular Weight | 565.46 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | (1'S,2'R,3S,3'aR)-1',2'-bis(2-chlorobenzoyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | O=C(c1ccccc1Cl)[C@@H]1[C@H](C(=O)c2ccccc2Cl)[C@@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C33H22Cl2N2O3/c34-23-13-5-2-10-20(23)30(38)28-29(31(39)21-11-3-6-14-24(21)35)37-26-16-8-1-9-19(26)17-18-27(37)33(28)22-12-4-7-15-25(22)36-32(33)40/h1-18,27-29H,(H,36,40)/t27-,28-,29+,33+/m1/s1 |
| InChIKey | OMJMYGUAZPLAKZ-YGGCMVMVSA-N |
| XLogP | 6.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.46 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |