C33H36N2O5S — CID 124771222
(1R,9S,10R,12R,14S,15S)-9,15-bis(4-methoxyphenyl)-12-methyl-17-prop-2-enylsulfanyl-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6,16-tetraene-4,5-diol (PubChem CID 124771222) has the molecular formula C33H36N2O5S and a molecular weight of 572.73 g/mol. Its IUPAC name is (1R,9S,10R,12R,14S,15S)-9,15-bis(4-methoxyphenyl)-12-methyl-17-prop-2-enylsulfanyl-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6,16-tetraene-4,5-diol.
| Compound Name | (1R,9S,10R,12R,14S,15S)-9,15-bis(4-methoxyphenyl)-12-methyl-17-prop-2-enylsulfanyl-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6,16-tetraene-4,5-diol |
|---|---|
| PubChem CID | 124771222 |
| Molecular Formula | C33H36N2O5S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (1R,9S,10R,12R,14S,15S)-9,15-bis(4-methoxyphenyl)-12-methyl-17-prop-2-enylsulfanyl-2-oxa-16,18-diazatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6,16-tetraene-4,5-diol |
| SMILES | C=CCSC1=N[C@H](c2ccc(OC)cc2)[C@@H]2C[C@H](C)C[C@@H]3[C@@H](c4ccc(OC)cc4)c4ccc(O)c(O)c4O[C@]32N1 |
| InChI | InChI=1S/C33H36N2O5S/c1-5-16-41-32-34-29(21-8-12-23(39-4)13-9-21)26-18-19(2)17-25-28(20-6-10-22(38-3)11-7-20)24-14-15-27(36)30(37)31(24)40-33(25,26)35-32/h5-15,19,25-26,28-29,36-37H,1,16-18H2,2-4H3,(H,34,35)/t19-,25-,26+,28+,29-,33-/m1/s1 |
| InChIKey | IOTDTFACAVPCSM-GZTCFHISSA-N |
| XLogP | 6.62 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|