C31H27ClN6S — CID 124771248
(1R,9R,13R)-13-(2-chlorophenyl)-5,11-bis(4-methylphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile (PubChem CID 124771248) has the molecular formula C31H27ClN6S and a molecular weight of 551.12 g/mol. Its IUPAC name is (1R,9R,13R)-13-(2-chlorophenyl)-5,11-bis(4-methylphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile.
| Compound Name | (1R,9R,13R)-13-(2-chlorophenyl)-5,11-bis(4-methylphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile |
|---|---|
| PubChem CID | 124771248 |
| Molecular Formula | C31H27ClN6S |
| Molecular Weight | 551.12 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | (1R,9R,13R)-13-(2-chlorophenyl)-5,11-bis(4-methylphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile |
| SMILES | Cc1ccc(N2CN=C3N(C2)C(=S)[C@@]2(C#N)CN(c4ccc(C)cc4)C[C@@]3(C#N)[C@H]2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C31H27ClN6S/c1-21-7-11-23(12-8-21)36-17-30(15-33)27(25-5-3-4-6-26(25)32)31(16-34,18-36)29(39)38-20-37(19-35-28(30)38)24-13-9-22(2)10-14-24/h3-14,27H,17-20H2,1-2H3/t27-,30+,31+/m1/s1 |
| InChIKey | JBQIDLRIDQOVOZ-RDAHNBDFSA-N |
| XLogP | 6.06 |
| TPSA | 69.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.12 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|