C20H24FNO8S — CID 124771266
[(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(4-fluorophenyl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 124771266) has the molecular formula C20H24FNO8S and a molecular weight of 457.48 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(4-fluorophenyl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(4-fluorophenyl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124771266 |
| Molecular Formula | C20H24FNO8S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(4-fluorophenyl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1Sc1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FNO8S/c1-10(23)22-17-19(29-13(4)26)18(28-12(3)25)16(9-27-11(2)24)30-20(17)31-15-7-5-14(21)6-8-15/h5-8,16-20H,9H2,1-4H3,(H,22,23)/t16-,17+,18+,19+,20+/m1/s1 |
| InChIKey | JNGRMYDWJOJMDG-DEPCRRQNSA-N |
| XLogP | 1.57 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|