C23H19N3O6 — CID 124771280
(1R,2S,6R,7S,8S,12R)-10-(4-methoxyphenyl)-5-(4-nitrophenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 124771280) has the molecular formula C23H19N3O6 and a molecular weight of 433.42 g/mol. Its IUPAC name is (1R,2S,6R,7S,8S,12R)-10-(4-methoxyphenyl)-5-(4-nitrophenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1R,2S,6R,7S,8S,12R)-10-(4-methoxyphenyl)-5-(4-nitrophenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 124771280 |
| Molecular Formula | C23H19N3O6 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (1R,2S,6R,7S,8S,12R)-10-(4-methoxyphenyl)-5-(4-nitrophenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@@H]5C(c6ccc([N+](=O)[O-])cc6)=NO[C@@H]45)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C23H19N3O6/c1-31-14-8-6-12(7-9-14)25-22(27)17-15-10-16(18(17)23(25)28)21-19(15)20(24-32-21)11-2-4-13(5-3-11)26(29)30/h2-9,15-19,21H,10H2,1H3/t15-,16-,17+,18-,19-,21+/m1/s1 |
| InChIKey | KDZGOUZYBVKMTF-WCBHIPQGSA-N |
| XLogP | 2.78 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|