C25H21ClN2O3 — CID 124771326
N-(3-chloro-2-methylphenyl)-4-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide (PubChem CID 124771326) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-4-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide |
|---|---|
| PubChem CID | 124771326 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1ccc(N2C(=O)[C@@H]3[C@H]4C=C[C@@H]([C@@H]5C[C@H]45)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H21ClN2O3/c1-12-19(26)3-2-4-20(12)27-23(29)13-5-7-14(8-6-13)28-24(30)21-15-9-10-16(18-11-17(15)18)22(21)25(28)31/h2-10,15-18,21-22H,11H2,1H3,(H,27,29)/t15-,16-,17-,18+,21+,22+/m0/s1 |
| InChIKey | LXTFVQUUZFUHJM-NSZLKXBBSA-N |
| XLogP | 4.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|