C30H28N2O5 — CID 124771341
benzyl (3aR,4S,8aS,8bS)-4-(3-methoxyphenyl)-1,3-dioxo-2-phenyl-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate (PubChem CID 124771341) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is benzyl (3aR,4S,8aS,8bS)-4-(3-methoxyphenyl)-1,3-dioxo-2-phenyl-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate.
| Compound Name | benzyl (3aR,4S,8aS,8bS)-4-(3-methoxyphenyl)-1,3-dioxo-2-phenyl-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate |
|---|---|
| PubChem CID | 124771341 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | benzyl (3aR,4S,8aS,8bS)-4-(3-methoxyphenyl)-1,3-dioxo-2-phenyl-3a,4,6,7,8,8b-hexahydropyrrolo[3,4-a]pyrrolizine-8a-carboxylate |
| SMILES | COc1cccc([C@@H]2[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3[C@]3(C(=O)OCc4ccccc4)CCCN23)c1 |
| InChI | InChI=1S/C30H28N2O5/c1-36-23-15-8-12-21(18-23)26-24-25(28(34)32(27(24)33)22-13-6-3-7-14-22)30(16-9-17-31(26)30)29(35)37-19-20-10-4-2-5-11-20/h2-8,10-15,18,24-26H,9,16-17,19H2,1H3/t24-,25-,26-,30+/m1/s1 |
| InChIKey | MFNIPGOPRSBYLE-JALVRWGXSA-N |
| XLogP | 4.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|