C14H19F3N2O7 — CID 124771537
(2S,3R,4S,5S)-6-[N-methyl-2-nitro-4-(trifluoromethyl)anilino]hexane-1,2,3,4,5-pentol (PubChem CID 124771537) has the molecular formula C14H19F3N2O7 and a molecular weight of 384.31 g/mol. Its IUPAC name is (2S,3R,4S,5S)-6-[N-methyl-2-nitro-4-(trifluoromethyl)anilino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2S,3R,4S,5S)-6-[N-methyl-2-nitro-4-(trifluoromethyl)anilino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 124771537 |
| Molecular Formula | C14H19F3N2O7 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (2S,3R,4S,5S)-6-[N-methyl-2-nitro-4-(trifluoromethyl)anilino]hexane-1,2,3,4,5-pentol |
| SMILES | CN(C[C@H](O)[C@H](O)[C@H](O)[C@@H](O)CO)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19F3N2O7/c1-18(5-10(21)12(23)13(24)11(22)6-20)8-3-2-7(14(15,16)17)4-9(8)19(25)26/h2-4,10-13,20-24H,5-6H2,1H3/t10-,11-,12-,13+/m0/s1 |
| InChIKey | RXYPRVAOVPUNSX-ZDEQEGDKSA-N |
| XLogP | -0.51 |
| TPSA | 147.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|