C31H34N2O6 — CID 124773812
(3S,3aR,6aR)-5-(4-butoxyphenyl)-3-(3-methoxy-4-propoxyphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 124773812) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is (3S,3aR,6aR)-5-(4-butoxyphenyl)-3-(3-methoxy-4-propoxyphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aR)-5-(4-butoxyphenyl)-3-(3-methoxy-4-propoxyphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 124773812 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | (3S,3aR,6aR)-5-(4-butoxyphenyl)-3-(3-methoxy-4-propoxyphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCCCOc1ccc(N2C(=O)[C@@H]3[C@@H](c4ccc(OCCC)c(OC)c4)N(c4ccccc4)O[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C31H34N2O6/c1-4-6-19-37-24-15-13-22(14-16-24)32-30(34)27-28(21-12-17-25(38-18-5-2)26(20-21)36-3)33(39-29(27)31(32)35)23-10-8-7-9-11-23/h7-17,20,27-29H,4-6,18-19H2,1-3H3/t27-,28-,29-/m1/s1 |
| InChIKey | OYEMGILYTNZQOA-MPFGFTFXSA-N |
| XLogP | 5.71 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|