C18H22N4O4S — CID 124774056
4-[(3aR,5R,6S,6aS)-6-methoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]-2,6-diamino-4H-thiopyran-3,5-dicarbonitrile (PubChem CID 124774056) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-[(3aR,5R,6S,6aS)-6-methoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]-2,6-diamino-4H-thiopyran-3,5-dicarbonitrile.
| Compound Name | 4-[(3aR,5R,6S,6aS)-6-methoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]-2,6-diamino-4H-thiopyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 124774056 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-[(3aR,5R,6S,6aS)-6-methoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]-2,6-diamino-4H-thiopyran-3,5-dicarbonitrile |
| SMILES | CO[C@@H]1[C@@H]2OC3(CCCCC3)O[C@H]2O[C@@H]1C1C(C#N)=C(N)SC(N)=C1C#N |
| InChI | InChI=1S/C18H22N4O4S/c1-23-13-12(11-9(7-19)15(21)27-16(22)10(11)8-20)24-17-14(13)25-18(26-17)5-3-2-4-6-18/h11-14,17H,2-6,21-22H2,1H3/t12-,13+,14+,17-/m1/s1 |
| InChIKey | VQNWGPRGHHAATM-XJIUQZFPSA-N |
| XLogP | 1.55 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |