C22H32NO2+ — CID 124776084
[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl] 1-phenylcyclopentane-1-carboxylate (PubChem CID 124776084) has the molecular formula C22H32NO2+ and a molecular weight of 342.50 g/mol. Its IUPAC name is [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl] 1-phenylcyclopentane-1-carboxylate.
| Compound Name | [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl] 1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 124776084 |
| Molecular Formula | C22H32NO2+ |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl] 1-phenylcyclopentane-1-carboxylate |
| SMILES | C[N@+]12CCCC[C@H]1[C@@H](OC(=O)C1(c3ccccc3)CCCC1)CCC2 |
| InChI | InChI=1S/C22H32NO2/c1-23-16-8-5-12-19(23)20(13-9-17-23)25-21(24)22(14-6-7-15-22)18-10-3-2-4-11-18/h2-4,10-11,19-20H,5-9,12-17H2,1H3/q+1/t19-,20-,23+/m0/s1 |
| InChIKey | ZIVXSNSWRIBHKJ-SXWKCWPCSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|