C19H26N4O2 — CID 124776997
(3R,8aS)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 124776997) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (3R,8aS)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (3R,8aS)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 124776997 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (3R,8aS)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC(=O)N1CCc2cc(NC(=O)N3C[C@@H]4CCCN4C[C@H]3C)ccc21 |
| InChI | InChI=1S/C19H26N4O2/c1-13-11-21-8-3-4-17(21)12-23(13)19(25)20-16-5-6-18-15(10-16)7-9-22(18)14(2)24/h5-6,10,13,17H,3-4,7-9,11-12H2,1-2H3,(H,20,25)/t13-,17+/m1/s1 |
| InChIKey | HHMFLCOZFYUTKW-DYVFJYSZSA-N |
| XLogP | 2.30 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |