C17H30N4O — CID 124777150
(8S)-N-[(1S,3R)-3-ethoxy-2,2-dimethylcyclobutyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 124777150) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is (8S)-N-[(1S,3R)-3-ethoxy-2,2-dimethylcyclobutyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | (8S)-N-[(1S,3R)-3-ethoxy-2,2-dimethylcyclobutyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 124777150 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | (8S)-N-[(1S,3R)-3-ethoxy-2,2-dimethylcyclobutyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | CCO[C@@H]1C[C@H](N[C@H]2CCCn3nc(C(C)C)nc32)C1(C)C |
| InChI | InChI=1S/C17H30N4O/c1-6-22-14-10-13(17(14,4)5)18-12-8-7-9-21-16(12)19-15(20-21)11(2)3/h11-14,18H,6-10H2,1-5H3/t12-,13-,14+/m0/s1 |
| InChIKey | LMLJOYQFPRFQSL-MELADBBJSA-N |
| XLogP | 3.03 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |