C12H22N2O4 — CID 124777783
ethyl (2R)-2-[(2R,6R)-2-carbamoyl-6-methylmorpholin-4-yl]butanoate (PubChem CID 124777783) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is ethyl (2R)-2-[(2R,6R)-2-carbamoyl-6-methylmorpholin-4-yl]butanoate.
| Compound Name | ethyl (2R)-2-[(2R,6R)-2-carbamoyl-6-methylmorpholin-4-yl]butanoate |
|---|---|
| PubChem CID | 124777783 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | ethyl (2R)-2-[(2R,6R)-2-carbamoyl-6-methylmorpholin-4-yl]butanoate |
| SMILES | CCOC(=O)[C@@H](CC)N1C[C@@H](C)O[C@@H](C(N)=O)C1 |
| InChI | InChI=1S/C12H22N2O4/c1-4-9(12(16)17-5-2)14-6-8(3)18-10(7-14)11(13)15/h8-10H,4-7H2,1-3H3,(H2,13,15)/t8-,9-,10-/m1/s1 |
| InChIKey | KBDKXXJZZJBDMK-OPRDCNLKSA-N |
| XLogP | -0.10 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |