C16H29N5O2 — CID 124778787
N-(2,5-dimethylpyrazol-3-yl)-2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]acetamide (PubChem CID 124778787) has the molecular formula C16H29N5O2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-(2,5-dimethylpyrazol-3-yl)-2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]acetamide.
| Compound Name | N-(2,5-dimethylpyrazol-3-yl)-2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 124778787 |
| Molecular Formula | C16H29N5O2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | N-(2,5-dimethylpyrazol-3-yl)-2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]acetamide |
| SMILES | CCOCCN1CCN(CC(=O)Nc2cc(C)nn2C)C[C@H]1C |
| InChI | InChI=1S/C16H29N5O2/c1-5-23-9-8-21-7-6-20(11-14(21)3)12-16(22)17-15-10-13(2)18-19(15)4/h10,14H,5-9,11-12H2,1-4H3,(H,17,22)/t14-/m1/s1 |
| InChIKey | JYNXTBJIRVAFKT-CQSZACIVSA-N |
| XLogP | 0.71 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|