C20H19N3O3S — CID 124779748
(1S,2R,8R,11S,12S,13S)-5-oxo-16-phenyl-5λ4-thia-14,16,18-triazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione (PubChem CID 124779748) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is (1S,2R,8R,11S,12S,13S)-5-oxo-16-phenyl-5λ4-thia-14,16,18-triazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione.
| Compound Name | (1S,2R,8R,11S,12S,13S)-5-oxo-16-phenyl-5λ4-thia-14,16,18-triazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione |
|---|---|
| PubChem CID | 124779748 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (1S,2R,8R,11S,12S,13S)-5-oxo-16-phenyl-5λ4-thia-14,16,18-triazaheptacyclo[9.7.0.02,8.02,9.08,13.010,12.014,18]octadecane-15,17-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@H]1[C@H]3C4C5[C@@]16CCS(=O)CC[C@@]56[C@@H]2[C@@H]43 |
| InChI | InChI=1S/C20H19N3O3S/c24-17-21(10-4-2-1-3-5-10)18(25)23-16-13-11-12(13)15(22(17)23)19-6-8-27(26)9-7-20(16,19)14(11)19/h1-5,11-16H,6-9H2/t11?,12-,13-,14?,15-,16-,19-,20-,27?/m0/s1 |
| InChIKey | RJOVTMHCDKITPS-UUKPGWKSSA-N |
| XLogP | 0.93 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |