C15H22N4O3S — CID 124780100
(4aR,9aS)-4-cyclopropylsulfonyl-7-pyrimidin-2-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine (PubChem CID 124780100) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is (4aR,9aS)-4-cyclopropylsulfonyl-7-pyrimidin-2-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine.
| Compound Name | (4aR,9aS)-4-cyclopropylsulfonyl-7-pyrimidin-2-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine |
|---|---|
| PubChem CID | 124780100 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (4aR,9aS)-4-cyclopropylsulfonyl-7-pyrimidin-2-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepine |
| SMILES | O=S(=O)(C1CC1)N1CCO[C@H]2CCN(c3ncccn3)CC[C@H]21 |
| InChI | InChI=1S/C15H22N4O3S/c20-23(21,12-2-3-12)19-10-11-22-14-5-9-18(8-4-13(14)19)15-16-6-1-7-17-15/h1,6-7,12-14H,2-5,8-11H2/t13-,14+/m1/s1 |
| InChIKey | YCIHFPYKODVWKN-KGLIPLIRSA-N |
| XLogP | 0.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |