C22H20F3NO2 — CID 124780387
4-[(1S,2S,10R,11R,12S)-7-(trifluoromethyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-10-yl]benzoic acid (PubChem CID 124780387) has the molecular formula C22H20F3NO2 and a molecular weight of 387.40 g/mol. Its IUPAC name is 4-[(1S,2S,10R,11R,12S)-7-(trifluoromethyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-10-yl]benzoic acid.
| Compound Name | 4-[(1S,2S,10R,11R,12S)-7-(trifluoromethyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-10-yl]benzoic acid |
|---|---|
| PubChem CID | 124780387 |
| Molecular Formula | C22H20F3NO2 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-[(1S,2S,10R,11R,12S)-7-(trifluoromethyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-10-yl]benzoic acid |
| SMILES | O=C(O)c1ccc([C@@H]2Nc3c(cccc3C(F)(F)F)[C@H]3[C@H]4CC[C@@H](C4)[C@H]32)cc1 |
| InChI | InChI=1S/C22H20F3NO2/c23-22(24,25)16-3-1-2-15-17-13-8-9-14(10-13)18(17)19(26-20(15)16)11-4-6-12(7-5-11)21(27)28/h1-7,13-14,17-19,26H,8-10H2,(H,27,28)/t13-,14-,17+,18+,19-/m0/s1 |
| InChIKey | JEKDKCXMCKGVEY-JCTKKGROSA-N |
| XLogP | 5.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |