C19H21FN4O2 — CID 124780736
N-[[(3R,3aR,6aR)-5-[(2-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridazine-4-carboxamide (PubChem CID 124780736) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is N-[[(3R,3aR,6aR)-5-[(2-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[(3R,3aR,6aR)-5-[(2-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 124780736 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[[(3R,3aR,6aR)-5-[(2-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyridazine-4-carboxamide |
| SMILES | O=C(NC[C@@H]1CO[C@H]2CN(Cc3ccccc3F)C[C@@H]12)c1ccnnc1 |
| InChI | InChI=1S/C19H21FN4O2/c20-17-4-2-1-3-14(17)9-24-10-16-15(12-26-18(16)11-24)7-21-19(25)13-5-6-22-23-8-13/h1-6,8,15-16,18H,7,9-12H2,(H,21,25)/t15-,16+,18+/m1/s1 |
| InChIKey | RBWFHCQHJWZWBS-RYRKJORJSA-N |
| XLogP | 1.49 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |