About (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid
(2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 124781074) has the molecular formula C11H15F3N2O4
and a molecular weight of 296.25 g/mol. Its IUPAC name is (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid |
| PubChem CID | 124781074 |
| Molecular Formula | C11H15F3N2O4 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | C[C@H](C(=O)O)N(C)C(=O)[C@@H]1CC[C@@H](C(F)(F)F)NC1=O |
| InChI | InChI=1S/C11H15F3N2O4/c1-5(10(19)20)16(2)9(18)6-3-4-7(11(12,13)14)15-8(6)17/h5-7H,3-4H2,1-2H3,(H,15,17)(H,19,20)/t5-,6-,7+/m1/s1 |
| InChIKey | ZSAZRTUBCICENF-QYNIQEEDSA-N |
| XLogP | 0.38 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid?
The IUPAC name of (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid (CID 124781074) is (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid.
What is the SMILES notation for (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid?
The canonical SMILES for (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid is C[C@H](C(=O)O)N(C)C(=O)[C@@H]1CC[C@@H](C(F)(F)F)NC1=O.
What is the InChIKey of (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid?
The InChIKey is ZSAZRTUBCICENF-QYNIQEEDSA-N. The full InChI is InChI=1S/C11H15F3N2O4/c1-5(10(19)20)16(2)9(18)6-3-4-7(11(12,13)14)15-8(6)17/h5-7H,3-4H2,1-2H3,(H,15,17)(H,19,20)/t5-,6-,7+/m1/s1.
What are the key properties of (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid?
(2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid has a molecular weight of 296.25 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[methyl-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]amino]propanoic acid is sourced from PubChem (CID 124781074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).