C22H23N3O3 — CID 124782485
(1'R,2S,2'S,4'S)-4-oxo-N-(pyridin-2-ylmethyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide (PubChem CID 124782485) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (1'R,2S,2'S,4'S)-4-oxo-N-(pyridin-2-ylmethyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide.
| Compound Name | (1'R,2S,2'S,4'S)-4-oxo-N-(pyridin-2-ylmethyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
|---|---|
| PubChem CID | 124782485 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (1'R,2S,2'S,4'S)-4-oxo-N-(pyridin-2-ylmethyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
| SMILES | O=C1N[C@@]2(C[C@H]3CC[C@H]2C[C@@H]3C(=O)NCc2ccccn2)Oc2ccccc21 |
| InChI | InChI=1S/C22H23N3O3/c26-20(24-13-16-5-3-4-10-23-16)18-11-15-9-8-14(18)12-22(15)25-21(27)17-6-1-2-7-19(17)28-22/h1-7,10,14-15,18H,8-9,11-13H2,(H,24,26)(H,25,27)/t14-,15+,18+,22+/m1/s1 |
| InChIKey | RZRXQZIPABIJGK-CAAIWKOSSA-N |
| XLogP | 2.65 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |