C19H24N2OS — CID 124782772
(1R,2S,4S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide (PubChem CID 124782772) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is (1R,2S,4S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide.
| Compound Name | (1R,2S,4S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
|---|---|
| PubChem CID | 124782772 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (1R,2S,4S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CCCCCC2)[C@H]1C[C@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C19H24N2OS/c22-17(13-11-12-7-8-14(13)19(12)9-10-19)21-18-20-15-5-3-1-2-4-6-16(15)23-18/h7-8,12-14H,1-6,9-11H2,(H,20,21,22)/t12-,13+,14-/m1/s1 |
| InChIKey | VDMHBLZZKLQJCE-HZSPNIEDSA-N |
| XLogP | 4.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|