C14H15FN4OS — CID 124783256
(2R,3aR,7aR)-6-(5-fluoropyrimidin-2-yl)-2-(1,3-thiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine (PubChem CID 124783256) has the molecular formula C14H15FN4OS and a molecular weight of 306.37 g/mol. Its IUPAC name is (2R,3aR,7aR)-6-(5-fluoropyrimidin-2-yl)-2-(1,3-thiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine.
| Compound Name | (2R,3aR,7aR)-6-(5-fluoropyrimidin-2-yl)-2-(1,3-thiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 124783256 |
| Molecular Formula | C14H15FN4OS |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (2R,3aR,7aR)-6-(5-fluoropyrimidin-2-yl)-2-(1,3-thiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
| SMILES | Fc1cnc(N2CC[C@@H]3C[C@H](c4nccs4)O[C@H]3C2)nc1 |
| InChI | InChI=1S/C14H15FN4OS/c15-10-6-17-14(18-7-10)19-3-1-9-5-11(20-12(9)8-19)13-16-2-4-21-13/h2,4,6-7,9,11-12H,1,3,5,8H2/t9-,11-,12+/m1/s1 |
| InChIKey | NFUOCSQXOKWIRO-JLLWLGSASA-N |
| XLogP | 2.43 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |