C17H24FN3O3 — CID 124783369
(8S)-2-(5-fluoropyrimidin-2-yl)-8-(oxan-4-ylmethoxymethyl)-5-oxa-2-azaspiro[3.4]octane (PubChem CID 124783369) has the molecular formula C17H24FN3O3 and a molecular weight of 337.40 g/mol. Its IUPAC name is (8S)-2-(5-fluoropyrimidin-2-yl)-8-(oxan-4-ylmethoxymethyl)-5-oxa-2-azaspiro[3.4]octane.
| Compound Name | (8S)-2-(5-fluoropyrimidin-2-yl)-8-(oxan-4-ylmethoxymethyl)-5-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 124783369 |
| Molecular Formula | C17H24FN3O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (8S)-2-(5-fluoropyrimidin-2-yl)-8-(oxan-4-ylmethoxymethyl)-5-oxa-2-azaspiro[3.4]octane |
| SMILES | Fc1cnc(N2CC3(C2)OCC[C@H]3COCC2CCOCC2)nc1 |
| InChI | InChI=1S/C17H24FN3O3/c18-15-7-19-16(20-8-15)21-11-17(12-21)14(3-6-24-17)10-23-9-13-1-4-22-5-2-13/h7-8,13-14H,1-6,9-12H2/t14-/m0/s1 |
| InChIKey | OJDSPFKEYXJWFY-AWEZNQCLSA-N |
| XLogP | 1.65 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |