C18H28O4Si2 — CID 124783515
bis(trimethylsilyl) (1S,2R,5R,6S,7R,8R)-tricyclo[4.2.2.02,5]deca-3,9-diene-7,8-dicarboxylate (PubChem CID 124783515) has the molecular formula C18H28O4Si2 and a molecular weight of 364.59 g/mol. Its IUPAC name is bis(trimethylsilyl) (1S,2R,5R,6S,7R,8R)-tricyclo[4.2.2.02,5]deca-3,9-diene-7,8-dicarboxylate.
| Compound Name | bis(trimethylsilyl) (1S,2R,5R,6S,7R,8R)-tricyclo[4.2.2.02,5]deca-3,9-diene-7,8-dicarboxylate |
|---|---|
| PubChem CID | 124783515 |
| Molecular Formula | C18H28O4Si2 |
| Molecular Weight | 364.59 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | bis(trimethylsilyl) (1S,2R,5R,6S,7R,8R)-tricyclo[4.2.2.02,5]deca-3,9-diene-7,8-dicarboxylate |
| SMILES | C[Si](C)(C)OC(=O)[C@@H]1[C@H]2C=C[C@@H]([C@@H]3C=C[C@H]32)[C@H]1C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C18H28O4Si2/c1-23(2,3)21-17(19)15-13-9-10-14(12-8-7-11(12)13)16(15)18(20)22-24(4,5)6/h7-16H,1-6H3/t11-,12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | QEWRIHXEVMMUJR-OWDFPOFWSA-N |
| XLogP | 3.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|