C12H17FN4O3S — CID 124783697
N-[[(3R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide (PubChem CID 124783697) has the molecular formula C12H17FN4O3S and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[[(3R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 124783697 |
| Molecular Formula | C12H17FN4O3S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[[(3R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@@H]1CO[C@@H]2CN(c3ncc(F)cn3)C[C@H]12 |
| InChI | InChI=1S/C12H17FN4O3S/c1-21(18,19)16-2-8-7-20-11-6-17(5-10(8)11)12-14-3-9(13)4-15-12/h3-4,8,10-11,16H,2,5-7H2,1H3/t8-,10-,11-/m1/s1 |
| InChIKey | SHLAIXGCTQDOIO-FBIMIBRVSA-N |
| XLogP | -0.38 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |