C13H24OSi — CID 124783835
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]oxy-trimethylsilane (PubChem CID 124783835) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]oxy-trimethylsilane.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 124783835 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1=CCC[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C13H24OSi/c1-15(2,3)14-13-10-6-8-11-7-4-5-9-12(11)13/h10-12H,4-9H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | UUXGXVJTYSBNMG-VXGBXAGGSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|